C24H42O10S — CID 118654549
1-[2,3,4-tris(2-hydroxypropoxy)butoxy]propan-2-yl 4-ethylbenzenesulfonate (PubChem CID 118654549) has the molecular formula C24H42O10S and a molecular weight of 522.66 g/mol. Its IUPAC name is 1-[2,3,4-tris(2-hydroxypropoxy)butoxy]propan-2-yl 4-ethylbenzenesulfonate.
| Compound Name | 1-[2,3,4-tris(2-hydroxypropoxy)butoxy]propan-2-yl 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 118654549 |
| Molecular Formula | C24H42O10S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 1-[2,3,4-tris(2-hydroxypropoxy)butoxy]propan-2-yl 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)OC(C)COCC(OCC(C)O)C(COCC(C)O)OCC(C)O)cc1 |
| InChI | InChI=1S/C24H42O10S/c1-6-21-7-9-22(10-8-21)35(28,29)34-20(5)14-31-16-24(33-13-19(4)27)23(32-12-18(3)26)15-30-11-17(2)25/h7-10,17-20,23-27H,6,11-16H2,1-5H3 |
| InChIKey | ZBMMLQGSXUNPKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|