C21H28N2O4 — CID 146071487
ethyl 5-hydroxy-1,2-dimethyl-4-(2-methylimino-4-oxoheptan-3-yl)indole-3-carboxylate (PubChem CID 146071487) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl 5-hydroxy-1,2-dimethyl-4-(2-methylimino-4-oxoheptan-3-yl)indole-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-1,2-dimethyl-4-(2-methylimino-4-oxoheptan-3-yl)indole-3-carboxylate |
|---|---|
| PubChem CID | 146071487 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethyl 5-hydroxy-1,2-dimethyl-4-(2-methylimino-4-oxoheptan-3-yl)indole-3-carboxylate |
| SMILES | CCCC(=O)C(/C(C)=N/C)c1c(O)ccc2c1c(C(=O)OCC)c(C)n2C |
| InChI | InChI=1S/C21H28N2O4/c1-7-9-15(24)17(12(3)22-5)20-16(25)11-10-14-19(20)18(13(4)23(14)6)21(26)27-8-2/h10-11,17,25H,7-9H2,1-6H3/b22-12+ |
| InChIKey | VMVOOWNYIOIDNS-WSDLNYQXSA-N |
| XLogP | 3.91 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|