C15H30N2O2S2 — CID 146081004
4-[1-[2-(2-methylpropylsulfanyl)ethyl]piperidin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 146081004) has the molecular formula C15H30N2O2S2 and a molecular weight of 334.55 g/mol. Its IUPAC name is 4-[1-[2-(2-methylpropylsulfanyl)ethyl]piperidin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[1-[2-(2-methylpropylsulfanyl)ethyl]piperidin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 146081004 |
| Molecular Formula | C15H30N2O2S2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-[1-[2-(2-methylpropylsulfanyl)ethyl]piperidin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)CSCCN1CCC(N2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C15H30N2O2S2/c1-14(2)13-20-10-7-16-5-3-15(4-6-16)17-8-11-21(18,19)12-9-17/h14-15H,3-13H2,1-2H3 |
| InChIKey | ZRCHKCUNGUEALO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|