C15H17N3O4 — CID 146081078
3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-N-(pyridin-3-ylmethoxy)propanamide (PubChem CID 146081078) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-N-(pyridin-3-ylmethoxy)propanamide.
| Compound Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-N-(pyridin-3-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 146081078 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-N-(pyridin-3-ylmethoxy)propanamide |
| SMILES | CC1=C(C)C(=O)N(CCC(=O)NOCc2cccnc2)C1=O |
| InChI | InChI=1S/C15H17N3O4/c1-10-11(2)15(21)18(14(10)20)7-5-13(19)17-22-9-12-4-3-6-16-8-12/h3-4,6,8H,5,7,9H2,1-2H3,(H,17,19) |
| InChIKey | AYBNRQKHEWWKKW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|