C18H24N4O4 — CID 75361897
2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-3-ylmethoxy)acetamide (PubChem CID 75361897) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-3-ylmethoxy)acetamide.
| Compound Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-3-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 75361897 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(pyridin-3-ylmethoxy)acetamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NOCc1cccnc1)C2=O |
| InChI | InChI=1S/C18H24N4O4/c1-2-13-5-7-18(8-6-13)16(24)22(17(25)20-18)11-15(23)21-26-12-14-4-3-9-19-10-14/h3-4,9-10,13H,2,5-8,11-12H2,1H3,(H,20,25)(H,21,23) |
| InChIKey | OJRUUVIIDXRQQJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|