C13H18N2O3 — CID 146084972
(2-cyclohexyl-2-oxoethyl) 5-methyl-1H-pyrazole-3-carboxylate (PubChem CID 146084972) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2-cyclohexyl-2-oxoethyl) 5-methyl-1H-pyrazole-3-carboxylate.
| Compound Name | (2-cyclohexyl-2-oxoethyl) 5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 146084972 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2-cyclohexyl-2-oxoethyl) 5-methyl-1H-pyrazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)C2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C13H18N2O3/c1-9-7-11(15-14-9)13(17)18-8-12(16)10-5-3-2-4-6-10/h7,10H,2-6,8H2,1H3,(H,14,15) |
| InChIKey | XDLYPRYKGLHMPR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |