C17H22F3N3O2S — CID 146086528
4-N-phenyl-1-N-[2-(2,2,2-trifluoroethylsulfanyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 146086528) has the molecular formula C17H22F3N3O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-N-phenyl-1-N-[2-(2,2,2-trifluoroethylsulfanyl)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-phenyl-1-N-[2-(2,2,2-trifluoroethylsulfanyl)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 146086528 |
| Molecular Formula | C17H22F3N3O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-N-phenyl-1-N-[2-(2,2,2-trifluoroethylsulfanyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)NCCSCC(F)(F)F)CC1 |
| InChI | InChI=1S/C17H22F3N3O2S/c18-17(19,20)12-26-11-8-21-16(25)23-9-6-13(7-10-23)15(24)22-14-4-2-1-3-5-14/h1-5,13H,6-12H2,(H,21,25)(H,22,24) |
| InChIKey | AJLJJCNHNIEUOG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|