C15H13FN4O2 — CID 146091592
N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 146091592) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 146091592 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | N#Cc1ccc(NCCNC(=O)c2cc(F)ccc2O)nc1 |
| InChI | InChI=1S/C15H13FN4O2/c16-11-2-3-13(21)12(7-11)15(22)19-6-5-18-14-4-1-10(8-17)9-20-14/h1-4,7,9,21H,5-6H2,(H,18,20)(H,19,22) |
| InChIKey | AXEVGHOBXWQQBZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|