C17H25N7O2 — CID 146093390
[4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone (PubChem CID 146093390) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is [4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone.
| Compound Name | [4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146093390 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [4-(1H-1,2,4-triazol-5-ylmethyl)piperazin-1-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)N2CCN(Cc3ncn[nH]3)CC2)[C@H](C)O1 |
| InChI | InChI=1S/C17H25N7O2/c1-11-8-13-15(12(2)26-11)21-22(3)16(13)17(25)24-6-4-23(5-7-24)9-14-18-10-19-20-14/h10-12H,4-9H2,1-3H3,(H,18,19,20)/t11-,12+/m1/s1 |
| InChIKey | JXVSVJCYIYPIKI-NEPJUHHUSA-N |
| XLogP | 0.52 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |