C20H25N3O2 — CID 146100556
(7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone (PubChem CID 146100556) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone.
| Compound Name | (7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146100556 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
| SMILES | Cc1ccc2c(c1)CN(C(=O)c1c3c(nn1C)[C@H](C)O[C@H](C)C3)CC2 |
| InChI | InChI=1S/C20H25N3O2/c1-12-5-6-15-7-8-23(11-16(15)9-12)20(24)19-17-10-13(2)25-14(3)18(17)21-22(19)4/h5-6,9,13-14H,7-8,10-11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | HJLRTSSGJCJWMJ-KGLIPLIRSA-N |
| XLogP | 2.95 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |