C21H21N3 — CID 146095116
5-[(1R,2R)-2-phenylcyclopropyl]-N-(2-pyridin-2-ylethyl)pyridin-2-amine (PubChem CID 146095116) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-[(1R,2R)-2-phenylcyclopropyl]-N-(2-pyridin-2-ylethyl)pyridin-2-amine.
| Compound Name | 5-[(1R,2R)-2-phenylcyclopropyl]-N-(2-pyridin-2-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 146095116 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 5-[(1R,2R)-2-phenylcyclopropyl]-N-(2-pyridin-2-ylethyl)pyridin-2-amine |
| SMILES | c1ccc([C@@H]2C[C@H]2c2ccc(NCCc3ccccn3)nc2)cc1 |
| InChI | InChI=1S/C21H21N3/c1-2-6-16(7-3-1)19-14-20(19)17-9-10-21(24-15-17)23-13-11-18-8-4-5-12-22-18/h1-10,12,15,19-20H,11,13-14H2,(H,23,24)/t19-,20-/m0/s1 |
| InChIKey | TYYIVAHHOJJEOZ-PMACEKPBSA-N |
| XLogP | 4.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |