C17H29ClN2O4 — CID 146098352
tert-butyl 4-[(2-chloroacetyl)-(oxan-4-yl)amino]piperidine-1-carboxylate (PubChem CID 146098352) has the molecular formula C17H29ClN2O4 and a molecular weight of 360.88 g/mol. Its IUPAC name is tert-butyl 4-[(2-chloroacetyl)-(oxan-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-chloroacetyl)-(oxan-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146098352 |
| Molecular Formula | C17H29ClN2O4 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl 4-[(2-chloroacetyl)-(oxan-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(C(=O)CCl)C2CCOCC2)CC1 |
| InChI | InChI=1S/C17H29ClN2O4/c1-17(2,3)24-16(22)19-8-4-13(5-9-19)20(15(21)12-18)14-6-10-23-11-7-14/h13-14H,4-12H2,1-3H3 |
| InChIKey | QTTYCIGFNNRYIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|