C47H62O6 — CID 14609984
(4R,5R)-4,5-bis[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-(4,8-dimethylnonyl)-2-methyl-1,3-dioxolane (PubChem CID 14609984) has the molecular formula C47H62O6 and a molecular weight of 723.01 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-(4,8-dimethylnonyl)-2-methyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-(4,8-dimethylnonyl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 14609984 |
| Molecular Formula | C47H62O6 |
| Molecular Weight | 723.01 g/mol |
| Exact Mass | 722.45 |
| IUPAC Name | (4R,5R)-4,5-bis[(1R)-1,2-bis(phenylmethoxy)ethyl]-2-(4,8-dimethylnonyl)-2-methyl-1,3-dioxolane |
| SMILES | CC(C)CCCC(C)CCCC1(C)O[C@H]([C@@H](COCc2ccccc2)OCc2ccccc2)[C@@H]([C@@H](COCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C47H62O6/c1-37(2)19-17-20-38(3)21-18-30-47(4)52-45(43(50-33-41-26-13-7-14-27-41)35-48-31-39-22-9-5-10-23-39)46(53-47)44(51-34-42-28-15-8-16-29-42)36-49-32-40-24-11-6-12-25-40/h5-16,22-29,37-38,43-46H,17-21,30-36H2,1-4H3/t38?,43-,44-,45-,46-/m1/s1 |
| InChIKey | ROUJLVSBBSSPDR-SDBIKZIJSA-N |
| XLogP | 10.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.01 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |