C16H20N2O4 — CID 146099922
methyl (E)-5-[[3-(propanoylamino)benzoyl]amino]pent-2-enoate (PubChem CID 146099922) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl (E)-5-[[3-(propanoylamino)benzoyl]amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[[3-(propanoylamino)benzoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099922 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl (E)-5-[[3-(propanoylamino)benzoyl]amino]pent-2-enoate |
| SMILES | CCC(=O)Nc1cccc(C(=O)NCC/C=C/C(=O)OC)c1 |
| InChI | InChI=1S/C16H20N2O4/c1-3-14(19)18-13-8-6-7-12(11-13)16(21)17-10-5-4-9-15(20)22-2/h4,6-9,11H,3,5,10H2,1-2H3,(H,17,21)(H,18,19)/b9-4+ |
| InChIKey | SFPUJLBDFDNENL-RUDMXATFSA-N |
| XLogP | 1.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|