C14H16N6S2 — CID 146105270
6-ethyl-2-N,4-N-bis(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 146105270) has the molecular formula C14H16N6S2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 6-ethyl-2-N,4-N-bis(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-2-N,4-N-bis(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 146105270 |
| Molecular Formula | C14H16N6S2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 6-ethyl-2-N,4-N-bis(1,3-thiazol-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | CCc1cc(NCc2nccs2)nc(NCc2nccs2)n1 |
| InChI | InChI=1S/C14H16N6S2/c1-2-10-7-11(17-8-12-15-3-5-21-12)20-14(19-10)18-9-13-16-4-6-22-13/h3-7H,2,8-9H2,1H3,(H2,17,18,19,20) |
| InChIKey | LXVPKKLGASQOHT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |