C13H21N7S — CID 80782409
2-N,2-N,6-N-triethyl-4-N-(1,3-thiazol-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80782409) has the molecular formula C13H21N7S and a molecular weight of 307.43 g/mol. Its IUPAC name is 2-N,2-N,6-N-triethyl-4-N-(1,3-thiazol-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-triethyl-4-N-(1,3-thiazol-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80782409 |
| Molecular Formula | C13H21N7S |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-N,2-N,6-N-triethyl-4-N-(1,3-thiazol-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCc2nccs2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C13H21N7S/c1-4-14-11-17-12(16-9-10-15-7-8-21-10)19-13(18-11)20(5-2)6-3/h7-8H,4-6,9H2,1-3H3,(H2,14,16,17,18,19) |
| InChIKey | FEDNJIIXABSVEZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |