C10H9BrClNO2 — CID 146108306
N-(5-bromo-2,3-dihydro-1-benzofuran-4-yl)-2-chloroacetamide (PubChem CID 146108306) has the molecular formula C10H9BrClNO2 and a molecular weight of 290.54 g/mol. Its IUPAC name is N-(5-bromo-2,3-dihydro-1-benzofuran-4-yl)-2-chloroacetamide.
| Compound Name | N-(5-bromo-2,3-dihydro-1-benzofuran-4-yl)-2-chloroacetamide |
|---|---|
| PubChem CID | 146108306 |
| Molecular Formula | C10H9BrClNO2 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | N-(5-bromo-2,3-dihydro-1-benzofuran-4-yl)-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1c(Br)ccc2c1CCO2 |
| InChI | InChI=1S/C10H9BrClNO2/c11-7-1-2-8-6(3-4-15-8)10(7)13-9(14)5-12/h1-2H,3-5H2,(H,13,14) |
| InChIKey | GLQMIWIBDKPAQB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|