C22H27N3O3 — CID 146110895
(6-methoxyspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-yl)-[(5S,7R)-1,5,7-trimethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-yl]methanone (PubChem CID 146110895) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (6-methoxyspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-yl)-[(5S,7R)-1,5,7-trimethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-yl]methanone.
| Compound Name | (6-methoxyspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-yl)-[(5S,7R)-1,5,7-trimethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146110895 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (6-methoxyspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]-2-yl)-[(5S,7R)-1,5,7-trimethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazol-3-yl]methanone |
| SMILES | COc1ccc2c(c1)C1(CC1)CN(C(=O)c1nn(C)c3c1C[C@H](C)O[C@@H]3C)C2 |
| InChI | InChI=1S/C22H27N3O3/c1-13-9-17-19(23-24(3)20(17)14(2)28-13)21(26)25-11-15-5-6-16(27-4)10-18(15)22(12-25)7-8-22/h5-6,10,13-14H,7-9,11-12H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | YGRUVYJLEXMTRW-UONOGXRCSA-N |
| XLogP | 3.14 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |