C20H23NO4S — CID 146120467
[(3S,3aS,9bR)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol (PubChem CID 146120467) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [(3S,3aS,9bR)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,9bR)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 146120467 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [(3S,3aS,9bR)-1-[(4-methylsulfonylphenyl)methyl]-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-3-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc(CN2C[C@@H](CO)[C@@H]3COc4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-26(23,24)16-8-6-14(7-9-16)10-21-11-15(12-22)18-13-25-19-5-3-2-4-17(19)20(18)21/h2-9,15,18,20,22H,10-13H2,1H3/t15-,18-,20-/m0/s1 |
| InChIKey | SNJGPDMNWVPSJH-QSFXBCCZSA-N |
| XLogP | 2.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |