About 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid
5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid (PubChem CID 146126182) has the molecular formula C19H15N3O4
and a molecular weight of 349.35 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid |
| PubChem CID | 146126182 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)Nc2ccc3c(c2)CCO3)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H15N3O4/c23-18(20-13-6-7-17-12(10-13)8-9-26-17)16-11-15(19(24)25)21-22(16)14-4-2-1-3-5-14/h1-7,10-11H,8-9H2,(H,20,23)(H,24,25) |
| InChIKey | KINXABWDJNPOCE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid?
The IUPAC name of 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid (CID 146126182) is 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid is O=C(O)c1cc(C(=O)Nc2ccc3c(c2)CCO3)n(-c2ccccc2)n1.
What is the InChIKey of 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid?
The InChIKey is KINXABWDJNPOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4/c23-18(20-13-6-7-17-12(10-13)8-9-26-17)16-11-15(19(24)25)21-22(16)14-4-2-1-3-5-14/h1-7,10-11H,8-9H2,(H,20,23)(H,24,25).
What are the key properties of 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid?
5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid has a molecular weight of 349.35 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1-benzofuran-5-ylcarbamoyl)-1-phenylpyrazole-3-carboxylic acid is sourced from PubChem (CID 146126182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).