C13H19NO4S — CID 146126771
2-(2,6-dimethylphenyl)-N-(2-methoxyethylsulfonyl)acetamide (PubChem CID 146126771) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-N-(2-methoxyethylsulfonyl)acetamide.
| Compound Name | 2-(2,6-dimethylphenyl)-N-(2-methoxyethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 146126771 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-N-(2-methoxyethylsulfonyl)acetamide |
| SMILES | COCCS(=O)(=O)NC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C13H19NO4S/c1-10-5-4-6-11(2)12(10)9-13(15)14-19(16,17)8-7-18-3/h4-6H,7-9H2,1-3H3,(H,14,15) |
| InChIKey | OBFVKZCSHHFELM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |