C10H21NO4S2 — CID 71931662
N-(2-methoxyethylsulfonyl)-3-(2-methylpropylsulfanyl)propanamide (PubChem CID 71931662) has the molecular formula C10H21NO4S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is N-(2-methoxyethylsulfonyl)-3-(2-methylpropylsulfanyl)propanamide.
| Compound Name | N-(2-methoxyethylsulfonyl)-3-(2-methylpropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 71931662 |
| Molecular Formula | C10H21NO4S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-(2-methoxyethylsulfonyl)-3-(2-methylpropylsulfanyl)propanamide |
| SMILES | COCCS(=O)(=O)NC(=O)CCSCC(C)C |
| InChI | InChI=1S/C10H21NO4S2/c1-9(2)8-16-6-4-10(12)11-17(13,14)7-5-15-3/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | PCJWHZAXQOKZHJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|