About 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid
3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid (PubChem CID 146128948) has the molecular formula C14H15ClN2O5S
and a molecular weight of 358.80 g/mol. Its IUPAC name is 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid.
Molecular Properties
| Compound Name | 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid |
| PubChem CID | 146128948 |
| Molecular Formula | C14H15ClN2O5S |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid |
| SMILES | O=C1CC2(CCN(S(=O)(=O)c3ccc(C(=O)O)cc3Cl)C2)CN1 |
| InChI | InChI=1S/C14H15ClN2O5S/c15-10-5-9(13(19)20)1-2-11(10)23(21,22)17-4-3-14(8-17)6-12(18)16-7-14/h1-2,5H,3-4,6-8H2,(H,16,18)(H,19,20) |
| InChIKey | PABSENWUNOSHGT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid?
The IUPAC name of 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid (CID 146128948) is 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid.
What is the SMILES notation for 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid?
The canonical SMILES for 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid is O=C1CC2(CCN(S(=O)(=O)c3ccc(C(=O)O)cc3Cl)C2)CN1.
What is the InChIKey of 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid?
The InChIKey is PABSENWUNOSHGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O5S/c15-10-5-9(13(19)20)1-2-11(10)23(21,22)17-4-3-14(8-17)6-12(18)16-7-14/h1-2,5H,3-4,6-8H2,(H,16,18)(H,19,20).
What are the key properties of 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid?
3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid has a molecular weight of 358.80 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(8-oxo-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]benzoic acid is sourced from PubChem (CID 146128948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).