C18H15F3N4O — CID 146129449
1-benzyl-1-(1H-pyrazol-5-ylmethyl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 146129449) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-benzyl-1-(1H-pyrazol-5-ylmethyl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-benzyl-1-(1H-pyrazol-5-ylmethyl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 146129449 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-benzyl-1-(1H-pyrazol-5-ylmethyl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)N(Cc1ccccc1)Cc1ccn[nH]1 |
| InChI | InChI=1S/C18H15F3N4O/c19-15-8-14(9-16(20)17(15)21)23-18(26)25(11-13-6-7-22-24-13)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,22,24)(H,23,26) |
| InChIKey | OKDYAXKAXIQRRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|