C22H25FN4O2 — CID 146130760
1-[1-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]piperidin-4-yl]-3-phenylurea (PubChem CID 146130760) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[1-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 146130760 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[1-[1-(4-fluorophenyl)-2-oxopyrrolidin-3-yl]piperidin-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1CCN(C2CCN(c3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C22H25FN4O2/c23-16-6-8-19(9-7-16)27-15-12-20(21(27)28)26-13-10-18(11-14-26)25-22(29)24-17-4-2-1-3-5-17/h1-9,18,20H,10-15H2,(H2,24,25,29) |
| InChIKey | MJJWNOUAFNVAMM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |