About 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone
1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone (PubChem CID 146132062) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone.
Molecular Properties
| Compound Name | 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone |
| PubChem CID | 146132062 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)N1Cc2ccccc2CO1 |
| InChI | InChI=1S/C15H13NO2/c17-15(12-6-2-1-3-7-12)16-10-13-8-4-5-9-14(13)11-18-16/h1-9H,10-11H2 |
| InChIKey | NLVZQRRWAGZRLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone?
The IUPAC name of 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone (CID 146132062) is 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone.
What is the SMILES notation for 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone?
The canonical SMILES for 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone is O=C(c1ccccc1)N1Cc2ccccc2CO1.
What is the InChIKey of 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone?
The InChIKey is NLVZQRRWAGZRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c17-15(12-6-2-1-3-7-12)16-10-13-8-4-5-9-14(13)11-18-16/h1-9H,10-11H2.
What are the key properties of 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone?
1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone has a molecular weight of 239.27 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone is sourced from PubChem (CID 146132062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).