C15H13NO2 — CID 146132062
1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone (PubChem CID 146132062) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone.
| Compound Name | 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone |
|---|---|
| PubChem CID | 146132062 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1,4-dihydro-2,3-benzoxazin-3-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)N1Cc2ccccc2CO1 |
| InChI | InChI=1S/C15H13NO2/c17-15(12-6-2-1-3-7-12)16-10-13-8-4-5-9-14(13)11-18-16/h1-9H,10-11H2 |
| InChIKey | NLVZQRRWAGZRLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |