C14H15ClF2N2O3 — CID 146132092
N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(6-oxopiperidin-2-yl)acetamide (PubChem CID 146132092) has the molecular formula C14H15ClF2N2O3 and a molecular weight of 332.73 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(6-oxopiperidin-2-yl)acetamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(6-oxopiperidin-2-yl)acetamide |
|---|---|
| PubChem CID | 146132092 |
| Molecular Formula | C14H15ClF2N2O3 |
| Molecular Weight | 332.73 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(6-oxopiperidin-2-yl)acetamide |
| SMILES | O=C(CC1CCCC(=O)N1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClF2N2O3/c15-10-6-9(4-5-11(10)22-14(16)17)19-13(21)7-8-2-1-3-12(20)18-8/h4-6,8,14H,1-3,7H2,(H,18,20)(H,19,21) |
| InChIKey | PNSYVWKYYUXZOA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |