C19H20N4O — CID 146145846
3-[1-cyclopentyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 146145846) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-[1-cyclopentyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[1-cyclopentyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 146145846 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-[1-cyclopentyl-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | COc1ccc(-c2nc(-c3cccnc3)nn2C2CCCC2)cc1 |
| InChI | InChI=1S/C19H20N4O/c1-24-17-10-8-14(9-11-17)19-21-18(15-5-4-12-20-13-15)22-23(19)16-6-2-3-7-16/h4-5,8-13,16H,2-3,6-7H2,1H3 |
| InChIKey | NORRXMPRADKLQG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |