About 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole
1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole (PubChem CID 19587444) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole.
Molecular Properties
| Compound Name | 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole |
| PubChem CID | 19587444 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole |
| SMILES | CCc1c(-c2ccc(OC)cc2)nn(C2CCCC2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-4-22-23(17-9-13-20(27-2)14-10-17)25-26(19-7-5-6-8-19)24(22)18-11-15-21(28-3)16-12-18/h9-16,19H,4-8H2,1-3H3 |
| InChIKey | YUKBPMYPMRKHTD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole?
The IUPAC name of 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole (CID 19587444) is 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole.
What is the SMILES notation for 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole?
The canonical SMILES for 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole is CCc1c(-c2ccc(OC)cc2)nn(C2CCCC2)c1-c1ccc(OC)cc1.
What is the InChIKey of 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole?
The InChIKey is YUKBPMYPMRKHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O2/c1-4-22-23(17-9-13-20(27-2)14-10-17)25-26(19-7-5-6-8-19)24(22)18-11-15-21(28-3)16-12-18/h9-16,19H,4-8H2,1-3H3.
What are the key properties of 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole?
1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole has a molecular weight of 376.50 g/mol, XLogP of 5.91, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-4-ethyl-3,5-bis(4-methoxyphenyl)pyrazole is sourced from PubChem (CID 19587444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).