C32H40N2O2 — CID 90988946
[4-(1-cyclobutyl-4-ethyl-3-phenylpyrazol-5-yl)phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 90988946) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is [4-(1-cyclobutyl-4-ethyl-3-phenylpyrazol-5-yl)phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(1-cyclobutyl-4-ethyl-3-phenylpyrazol-5-yl)phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90988946 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | [4-(1-cyclobutyl-4-ethyl-3-phenylpyrazol-5-yl)phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(-c3c(CC)c(-c4ccccc4)nn3C3CCC3)cc2)CC1 |
| InChI | InChI=1S/C32H40N2O2/c1-3-5-10-23-15-17-26(18-16-23)32(35)36-28-21-19-25(20-22-28)31-29(4-2)30(24-11-7-6-8-12-24)33-34(31)27-13-9-14-27/h6-8,11-12,19-23,26-27H,3-5,9-10,13-18H2,1-2H3 |
| InChIKey | ARPSJDDTTPYLHN-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|