C19H19FN2O — CID 68884306
1-cyclopentyl-7-fluoro-3-(4-methoxyphenyl)indazole (PubChem CID 68884306) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-cyclopentyl-7-fluoro-3-(4-methoxyphenyl)indazole.
| Compound Name | 1-cyclopentyl-7-fluoro-3-(4-methoxyphenyl)indazole |
|---|---|
| PubChem CID | 68884306 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-cyclopentyl-7-fluoro-3-(4-methoxyphenyl)indazole |
| SMILES | COc1ccc(-c2nn(C3CCCC3)c3c(F)cccc23)cc1 |
| InChI | InChI=1S/C19H19FN2O/c1-23-15-11-9-13(10-12-15)18-16-7-4-8-17(20)19(16)22(21-18)14-5-2-3-6-14/h4,7-12,14H,2-3,5-6H2,1H3 |
| InChIKey | QOXNCHDNLWWLDK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |