C20H21ClN2O — CID 68885759
7-chloro-1-cyclopentyl-3-[(4-methoxyphenyl)methyl]indazole (PubChem CID 68885759) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 7-chloro-1-cyclopentyl-3-[(4-methoxyphenyl)methyl]indazole.
| Compound Name | 7-chloro-1-cyclopentyl-3-[(4-methoxyphenyl)methyl]indazole |
|---|---|
| PubChem CID | 68885759 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 7-chloro-1-cyclopentyl-3-[(4-methoxyphenyl)methyl]indazole |
| SMILES | COc1ccc(Cc2nn(C3CCCC3)c3c(Cl)cccc23)cc1 |
| InChI | InChI=1S/C20H21ClN2O/c1-24-16-11-9-14(10-12-16)13-19-17-7-4-8-18(21)20(17)23(22-19)15-5-2-3-6-15/h4,7-12,15H,2-3,5-6,13H2,1H3 |
| InChIKey | MUFGEZLOIZOFAH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |