About 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole
4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole (PubChem CID 19587515) has the molecular formula C24H27ClN2O4
and a molecular weight of 442.94 g/mol. Its IUPAC name is 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole.
Molecular Properties
| Compound Name | 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole |
| PubChem CID | 19587515 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole |
| SMILES | COc1ccc(-c2nn(C3CCCC3)c(-c3ccc(OC)c(OC)c3)c2Cl)cc1OC |
| InChI | InChI=1S/C24H27ClN2O4/c1-28-18-11-9-15(13-20(18)30-3)23-22(25)24(27(26-23)17-7-5-6-8-17)16-10-12-19(29-2)21(14-16)31-4/h9-14,17H,5-8H2,1-4H3 |
| InChIKey | KJLYZQYDGPHCLC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole?
The IUPAC name of 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole (CID 19587515) is 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole.
What is the SMILES notation for 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole?
The canonical SMILES for 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole is COc1ccc(-c2nn(C3CCCC3)c(-c3ccc(OC)c(OC)c3)c2Cl)cc1OC.
What is the InChIKey of 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole?
The InChIKey is KJLYZQYDGPHCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27ClN2O4/c1-28-18-11-9-15(13-20(18)30-3)23-22(25)24(27(26-23)17-7-5-6-8-17)16-10-12-19(29-2)21(14-16)31-4/h9-14,17H,5-8H2,1-4H3.
What are the key properties of 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole?
4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole has a molecular weight of 442.94 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-cyclopentyl-3,5-bis(3,4-dimethoxyphenyl)pyrazole is sourced from PubChem (CID 19587515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).