C27H31N5O2 — CID 74069390
(3-methoxyphenyl)-(2-pyridin-3-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone (PubChem CID 74069390) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is (3-methoxyphenyl)-(2-pyridin-3-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone.
| Compound Name | (3-methoxyphenyl)-(2-pyridin-3-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone |
|---|---|
| PubChem CID | 74069390 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (3-methoxyphenyl)-(2-pyridin-3-ylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)methanone |
| SMILES | COc1cccc(C(=O)N2c3nc(-c4cccnc4)nn3C3(CCCCC3)C3CCCCC32)c1 |
| InChI | InChI=1S/C27H31N5O2/c1-34-21-11-7-9-19(17-21)25(33)31-23-13-4-3-12-22(23)27(14-5-2-6-15-27)32-26(31)29-24(30-32)20-10-8-16-28-18-20/h7-11,16-18,22-23H,2-6,12-15H2,1H3 |
| InChIKey | VYKGVAKLIDEISR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |