C23H29N5O3 — CID 75157177
(2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-nitrophenyl)methanone (PubChem CID 75157177) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is (2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-nitrophenyl)methanone.
| Compound Name | (2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 75157177 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (2-ethylspiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl)-(3-nitrophenyl)methanone |
| SMILES | CCc1nc2n(n1)C1(CCCCC1)C1CCCCC1N2C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N5O3/c1-2-20-24-22-26(21(29)16-9-8-10-17(15-16)28(30)31)19-12-5-4-11-18(19)23(27(22)25-20)13-6-3-7-14-23/h8-10,15,18-19H,2-7,11-14H2,1H3 |
| InChIKey | DEADVDVSJPEMSC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|