C23H30N4O — CID 74069304
1-[2-(2-methylphenyl)spiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]ethanone (PubChem CID 74069304) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[2-(2-methylphenyl)spiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]ethanone.
| Compound Name | 1-[2-(2-methylphenyl)spiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]ethanone |
|---|---|
| PubChem CID | 74069304 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[2-(2-methylphenyl)spiro[4a,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[5,1-b]quinazoline-9,1'-cyclohexane]-4-yl]ethanone |
| SMILES | CC(=O)N1c2nc(-c3ccccc3C)nn2C2(CCCCC2)C2CCCCC21 |
| InChI | InChI=1S/C23H30N4O/c1-16-10-4-5-11-18(16)21-24-22-26(17(2)28)20-13-7-6-12-19(20)23(27(22)25-21)14-8-3-9-15-23/h4-5,10-11,19-20H,3,6-9,12-15H2,1-2H3 |
| InChIKey | QMJJWZUKGTWSFD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |