C15H14N6O4S — CID 146150733
methyl 4-[(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)sulfamoylmethyl]benzoate (PubChem CID 146150733) has the molecular formula C15H14N6O4S and a molecular weight of 374.38 g/mol. Its IUPAC name is methyl 4-[(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 146150733 |
| Molecular Formula | C15H14N6O4S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | methyl 4-[(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Nc2ncnn2-c2ncccn2)cc1 |
| InChI | InChI=1S/C15H14N6O4S/c1-25-13(22)12-5-3-11(4-6-12)9-26(23,24)20-15-18-10-19-21(15)14-16-7-2-8-17-14/h2-8,10H,9H2,1H3,(H,18,19,20) |
| InChIKey | JKCAOAJWMCGXMT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |