C17H18F2N4O — CID 146152633
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxamide (PubChem CID 146152633) has the molecular formula C17H18F2N4O and a molecular weight of 332.35 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 146152633 |
| Molecular Formula | C17H18F2N4O |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3,3-difluoro-1-pyridin-3-ylcyclobutane-1-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)C2(c3cccnc3)CC(F)(F)C2)N=N1 |
| InChI | InChI=1S/C17H18F2N4O/c1-2-3-6-17(22-23-17)7-9-21-14(24)15(11-16(18,19)12-15)13-5-4-8-20-10-13/h1,4-5,8,10H,3,6-7,9,11-12H2,(H,21,24) |
| InChIKey | FURHDKFKNPWATC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|