C20H22F3N5O2 — CID 166423282
N-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]-2,2,2-trifluoro-N-pyridin-3-ylacetamide (PubChem CID 166423282) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is N-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]-2,2,2-trifluoro-N-pyridin-3-ylacetamide.
| Compound Name | N-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]-2,2,2-trifluoro-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 166423282 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]-2,2,2-trifluoro-N-pyridin-3-ylacetamide |
| SMILES | C#CCCC1(CCC(=O)N2CCC(N(C(=O)C(F)(F)F)c3cccnc3)CC2)N=N1 |
| InChI | InChI=1S/C20H22F3N5O2/c1-2-3-9-19(25-26-19)10-6-17(29)27-12-7-15(8-13-27)28(18(30)20(21,22)23)16-5-4-11-24-14-16/h1,4-5,11,14-15H,3,6-10,12-13H2 |
| InChIKey | KZJABCWFLGDQRT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|