C16H19N5O — CID 167962924
3-(3-but-3-ynyldiazirin-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)propan-1-one (PubChem CID 167962924) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)propan-1-one.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 167962924 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-(1-methyl-2,3-dihydropyrido[3,4-b]pyrazin-4-yl)propan-1-one |
| SMILES | C#CCCC1(CCC(=O)N2CCN(C)c3ccncc32)N=N1 |
| InChI | InChI=1S/C16H19N5O/c1-3-4-7-16(18-19-16)8-5-15(22)21-11-10-20(2)13-6-9-17-12-14(13)21/h1,6,9,12H,4-5,7-8,10-11H2,2H3 |
| InChIKey | PKVVGRHFBPZWNG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|