C17H29NO2 — CID 14615620
5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]-2-phenylpentan-2-ol (PubChem CID 14615620) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]-2-phenylpentan-2-ol.
| Compound Name | 5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]-2-phenylpentan-2-ol |
|---|---|
| PubChem CID | 14615620 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]-2-phenylpentan-2-ol |
| SMILES | CC(C)[C@@H](CO)N(C)CCCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H29NO2/c1-14(2)16(13-19)18(4)12-8-11-17(3,20)15-9-6-5-7-10-15/h5-7,9-10,14,16,19-20H,8,11-13H2,1-4H3/t16-,17?/m1/s1 |
| InChIKey | BXPBXQFMZCNNKQ-TZHYSIJRSA-N |
| XLogP | 2.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |