C31H37NO10 — CID 146157276
[(2S,6R,10S)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate (PubChem CID 146157276) has the molecular formula C31H37NO10 and a molecular weight of 583.63 g/mol. Its IUPAC name is [(2S,6R,10S)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate.
| Compound Name | [(2S,6R,10S)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate |
|---|---|
| PubChem CID | 146157276 |
| Molecular Formula | C31H37NO10 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | [(2S,6R,10S)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)C(OC(C)=O)CC[C@@]2(C)C1CC(OC(C)=O)[C@@]1(C)Oc3cc(-c4cccnc4)oc(=O)c3C(O)C21 |
| InChI | InChI=1S/C31H37NO10/c1-16(33)38-15-30(5)22-13-24(40-18(3)35)31(6)27(29(22,4)10-9-23(30)39-17(2)34)26(36)25-21(42-31)12-20(41-28(25)37)19-8-7-11-32-14-19/h7-8,11-12,14,22-24,26-27,36H,9-10,13,15H2,1-6H3/t22?,23?,24?,26?,27?,29-,30-,31+/m0/s1 |
| InChIKey | PMMQOFWSZRQWEV-ATNZHTRVSA-N |
| XLogP | 3.76 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|