About 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride
6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 146157655) has the molecular formula C11H14ClNO2
and a molecular weight of 233.73 g/mol. Its IUPAC name is 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 146157655 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 233.73 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])CCN=C2 |
| InChI | InChI=1S/C11H13NO2.ClH/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2;/h5-7H,3-4H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | PQXVEYYRJHMTEV-TXHXQZCNSA-N |
| XLogP | 2.10 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride (CID 146157655) is 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride is Cl.[2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])CCN=C2.
What is the InChIKey of 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is PQXVEYYRJHMTEV-TXHXQZCNSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2;/h5-7H,3-4H2,1-2H3;1H/i1D3,2D3;.
What are the key properties of 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride?
6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 233.73 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 146157655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).