C11H14ClNO2 — CID 146157655
6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 146157655) has the molecular formula C11H14ClNO2 and a molecular weight of 233.73 g/mol. Its IUPAC name is 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride.
| Compound Name | 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 146157655 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 233.73 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6,7-bis(trideuteriomethoxy)-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])Oc1cc2c(cc1OC([2H])([2H])[2H])CCN=C2 |
| InChI | InChI=1S/C11H13NO2.ClH/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2;/h5-7H,3-4H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | PQXVEYYRJHMTEV-TXHXQZCNSA-N |
| XLogP | 2.10 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |