C24H21FN4O3 — CID 146160700
benzyl 8-ethyl-11-(4-fluorophenyl)-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-5-carboxylate (PubChem CID 146160700) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is benzyl 8-ethyl-11-(4-fluorophenyl)-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-5-carboxylate.
| Compound Name | benzyl 8-ethyl-11-(4-fluorophenyl)-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-5-carboxylate |
|---|---|
| PubChem CID | 146160700 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | benzyl 8-ethyl-11-(4-fluorophenyl)-2-oxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-5-carboxylate |
| SMILES | CCn1c2c(c(=O)n3nc(-c4ccc(F)cc4)cc13)CN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C24H21FN4O3/c1-2-28-21-14-27(24(31)32-15-16-6-4-3-5-7-16)13-19(21)23(30)29-22(28)12-20(26-29)17-8-10-18(25)11-9-17/h3-12H,2,13-15H2,1H3 |
| InChIKey | JAXIGYIVFJPQIO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |