C33H27FN4O2 — CID 167350301
benzyl 3-(benzhydrylideneamino)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 167350301) has the molecular formula C33H27FN4O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is benzyl 3-(benzhydrylideneamino)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | benzyl 3-(benzhydrylideneamino)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 167350301 |
| Molecular Formula | C33H27FN4O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | benzyl 3-(benzhydrylideneamino)-2-(4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCn2nc(-c3ccc(F)cc3)c(N=C(c3ccccc3)c3ccccc3)c2C1 |
| InChI | InChI=1S/C33H27FN4O2/c34-28-18-16-27(17-19-28)31-32(35-30(25-12-6-2-7-13-25)26-14-8-3-9-15-26)29-22-37(20-21-38(29)36-31)33(39)40-23-24-10-4-1-5-11-24/h1-19H,20-23H2 |
| InChIKey | ILRFZYWBOOLRIB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|