C18H30O4 — CID 146162390
[(5Z,7Z)-8-acetyloxy-2,11-dimethyldodeca-5,7-dien-5-yl] acetate (PubChem CID 146162390) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(5Z,7Z)-8-acetyloxy-2,11-dimethyldodeca-5,7-dien-5-yl] acetate.
| Compound Name | [(5Z,7Z)-8-acetyloxy-2,11-dimethyldodeca-5,7-dien-5-yl] acetate |
|---|---|
| PubChem CID | 146162390 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(5Z,7Z)-8-acetyloxy-2,11-dimethyldodeca-5,7-dien-5-yl] acetate |
| SMILES | CC(=O)O/C(=C\C=C(\CCC(C)C)OC(C)=O)CCC(C)C |
| InChI | InChI=1S/C18H30O4/c1-13(2)7-9-17(21-15(5)19)11-12-18(22-16(6)20)10-8-14(3)4/h11-14H,7-10H2,1-6H3/b17-11-,18-12- |
| InChIKey | PIIDJACAPWYNEU-WHYMJUELSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|