C24H19NO — CID 146162492
(Z)-1,3-diphenyl-3-(3-phenylprop-2-ynylamino)prop-2-en-1-one (PubChem CID 146162492) has the molecular formula C24H19NO and a molecular weight of 337.42 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-3-(3-phenylprop-2-ynylamino)prop-2-en-1-one.
| Compound Name | (Z)-1,3-diphenyl-3-(3-phenylprop-2-ynylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 146162492 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (Z)-1,3-diphenyl-3-(3-phenylprop-2-ynylamino)prop-2-en-1-one |
| SMILES | O=C(/C=C(\NCC#Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19NO/c26-24(22-16-8-3-9-17-22)19-23(21-14-6-2-7-15-21)25-18-10-13-20-11-4-1-5-12-20/h1-9,11-12,14-17,19,25H,18H2/b23-19- |
| InChIKey | XEWDJCVNMGPRDM-NMWGTECJSA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|