C21H19ClF3N3 — CID 146164379
3-tert-butylimino-N-(4-chlorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrrol-2-amine (PubChem CID 146164379) has the molecular formula C21H19ClF3N3 and a molecular weight of 405.85 g/mol. Its IUPAC name is 3-tert-butylimino-N-(4-chlorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrrol-2-amine.
| Compound Name | 3-tert-butylimino-N-(4-chlorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrrol-2-amine |
|---|---|
| PubChem CID | 146164379 |
| Molecular Formula | C21H19ClF3N3 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-tert-butylimino-N-(4-chlorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrrol-2-amine |
| SMILES | CC(C)(C)/N=C1\C=C(c2ccc(C(F)(F)F)cc2)N=C1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClF3N3/c1-20(2,3)28-18-12-17(13-4-6-14(7-5-13)21(23,24)25)27-19(18)26-16-10-8-15(22)9-11-16/h4-12H,1-3H3,(H,26,27,28) |
| InChIKey | JMANRPAKFIMORX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|