C20H19F3N4 — CID 175086482
5-tert-butylimino-2-phenyl-N-[4-(trifluoromethyl)phenyl]imidazol-4-amine (PubChem CID 175086482) has the molecular formula C20H19F3N4 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-tert-butylimino-2-phenyl-N-[4-(trifluoromethyl)phenyl]imidazol-4-amine.
| Compound Name | 5-tert-butylimino-2-phenyl-N-[4-(trifluoromethyl)phenyl]imidazol-4-amine |
|---|---|
| PubChem CID | 175086482 |
| Molecular Formula | C20H19F3N4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-tert-butylimino-2-phenyl-N-[4-(trifluoromethyl)phenyl]imidazol-4-amine |
| SMILES | CC(C)(C)/N=C1\N=C(c2ccccc2)N=C1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N4/c1-19(2,3)27-18-17(25-16(26-18)13-7-5-4-6-8-13)24-15-11-9-14(10-12-15)20(21,22)23/h4-12H,1-3H3,(H,24,25,26,27) |
| InChIKey | LQUWSZMITUKOSI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|