C21H26N2O2 — CID 146166955
(1'R,4'R)-5'-methylspiro[1,3-dioxolane-2,16'-tetracyclo[10.2.2.01,10.04,9]hexadec-13-ene]-5',9'-dicarbonitrile (PubChem CID 146166955) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (1'R,4'R)-5'-methylspiro[1,3-dioxolane-2,16'-tetracyclo[10.2.2.01,10.04,9]hexadec-13-ene]-5',9'-dicarbonitrile.
| Compound Name | (1'R,4'R)-5'-methylspiro[1,3-dioxolane-2,16'-tetracyclo[10.2.2.01,10.04,9]hexadec-13-ene]-5',9'-dicarbonitrile |
|---|---|
| PubChem CID | 146166955 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (1'R,4'R)-5'-methylspiro[1,3-dioxolane-2,16'-tetracyclo[10.2.2.01,10.04,9]hexadec-13-ene]-5',9'-dicarbonitrile |
| SMILES | CC1(C#N)CCCC2(C#N)C3CC4C=C[C@@]3(CC[C@H]12)CC41OCCO1 |
| InChI | InChI=1S/C21H26N2O2/c1-18(13-22)5-2-6-20(14-23)16(18)4-8-19-7-3-15(11-17(19)20)21(12-19)24-9-10-25-21/h3,7,15-17H,2,4-6,8-12H2,1H3/t15?,16-,17?,18?,19-,20?/m1/s1 |
| InChIKey | RFKLUJDBCIARCB-JSTQWCLSSA-N |
| XLogP | 3.95 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|